C17H17N5O6 — CID 5259918
[N,N-dimethyl-N'-(N-methyl-2,4-dinitroanilino)carbamimidoyl] benzoate (PubChem CID 5259918) has the molecular formula C17H17N5O6 and a molecular weight of 387.35 g/mol. Its IUPAC name is [N,N-dimethyl-N'-(N-methyl-2,4-dinitroanilino)carbamimidoyl] benzoate.
| Compound Name | [N,N-dimethyl-N'-(N-methyl-2,4-dinitroanilino)carbamimidoyl] benzoate |
|---|---|
| PubChem CID | 5259918 |
| Molecular Formula | C17H17N5O6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [N,N-dimethyl-N'-(N-methyl-2,4-dinitroanilino)carbamimidoyl] benzoate |
| SMILES | CN(C)C(=NN(C)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N5O6/c1-19(2)17(28-16(23)12-7-5-4-6-8-12)18-20(3)14-10-9-13(21(24)25)11-15(14)22(26)27/h4-11H,1-3H3 |
| InChIKey | DYKAPDARVGAMEF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 131.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|