C16H12N4O7 — CID 135404772
methyl (E)-2-[(2,4-dinitrophenyl)diazenyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135404772) has the molecular formula C16H12N4O7 and a molecular weight of 372.29 g/mol. Its IUPAC name is methyl (E)-2-[(2,4-dinitrophenyl)diazenyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | methyl (E)-2-[(2,4-dinitrophenyl)diazenyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135404772 |
| Molecular Formula | C16H12N4O7 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | methyl (E)-2-[(2,4-dinitrophenyl)diazenyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | COC(=O)C(/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])=C(\O)c1ccccc1 |
| InChI | InChI=1S/C16H12N4O7/c1-27-16(22)14(15(21)10-5-3-2-4-6-10)18-17-12-8-7-11(19(23)24)9-13(12)20(25)26/h2-9,21H,1H3/b15-14+,18-17+ |
| InChIKey | MBEALQKAHKRUMI-QYWXAPKASA-N |
| XLogP | 3.69 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|