About 1,3-dinitrobenzene;methyl benzoate
1,3-dinitrobenzene;methyl benzoate (PubChem CID 174443884) has the molecular formula C14H12N2O6
and a molecular weight of 304.26 g/mol. Its IUPAC name is 1,3-dinitrobenzene;methyl benzoate.
Molecular Properties
| Compound Name | 1,3-dinitrobenzene;methyl benzoate |
| PubChem CID | 174443884 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1,3-dinitrobenzene;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8O2.C6H4N2O4/c1-10-8(9)7-5-3-2-4-6-7;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-6H,1H3;1-4H |
| InChIKey | IPAZWCDJSLYXGI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitrobenzene;methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitrobenzene;methyl benzoate?
The IUPAC name of 1,3-dinitrobenzene;methyl benzoate (CID 174443884) is 1,3-dinitrobenzene;methyl benzoate.
What is the SMILES notation for 1,3-dinitrobenzene;methyl benzoate?
The canonical SMILES for 1,3-dinitrobenzene;methyl benzoate is COC(=O)c1ccccc1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1,3-dinitrobenzene;methyl benzoate?
The InChIKey is IPAZWCDJSLYXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H4N2O4/c1-10-8(9)7-5-3-2-4-6-7;9-7(10)5-2-1-3-6(4-5)8(11)12/h2-6H,1H3;1-4H.
What are the key properties of 1,3-dinitrobenzene;methyl benzoate?
1,3-dinitrobenzene;methyl benzoate has a molecular weight of 304.26 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitrobenzene;methyl benzoate is sourced from PubChem (CID 174443884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).