About methyl 3-nitrobenzoate;sulfuryl dichloride
methyl 3-nitrobenzoate;sulfuryl dichloride (PubChem CID 160807486) has the molecular formula C8H7Cl2NO6S
and a molecular weight of 316.12 g/mol. Its IUPAC name is methyl 3-nitrobenzoate;sulfuryl dichloride.
Molecular Properties
| Compound Name | methyl 3-nitrobenzoate;sulfuryl dichloride |
| PubChem CID | 160807486 |
| Molecular Formula | C8H7Cl2NO6S |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | methyl 3-nitrobenzoate;sulfuryl dichloride |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C8H7NO4.Cl2O2S/c1-13-8(10)6-3-2-4-7(5-6)9(11)12;1-5(2,3)4/h2-5H,1H3; |
| InChIKey | SDWNUOYKZJSCMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-nitrobenzoate;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-nitrobenzoate;sulfuryl dichloride?
The IUPAC name of methyl 3-nitrobenzoate;sulfuryl dichloride (CID 160807486) is methyl 3-nitrobenzoate;sulfuryl dichloride.
What is the SMILES notation for methyl 3-nitrobenzoate;sulfuryl dichloride?
The canonical SMILES for methyl 3-nitrobenzoate;sulfuryl dichloride is COC(=O)c1cccc([N+](=O)[O-])c1.O=S(=O)(Cl)Cl.
What is the InChIKey of methyl 3-nitrobenzoate;sulfuryl dichloride?
The InChIKey is SDWNUOYKZJSCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4.Cl2O2S/c1-13-8(10)6-3-2-4-7(5-6)9(11)12;1-5(2,3)4/h2-5H,1H3;.
What are the key properties of methyl 3-nitrobenzoate;sulfuryl dichloride?
methyl 3-nitrobenzoate;sulfuryl dichloride has a molecular weight of 316.12 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-nitrobenzoate;sulfuryl dichloride is sourced from PubChem (CID 160807486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).