C17H10N4O7 — CID 71357558
3-[(2,4-dinitrophenyl)diazenyl]oxynaphthalene-2-carboxylic acid (PubChem CID 71357558) has the molecular formula C17H10N4O7 and a molecular weight of 382.29 g/mol. Its IUPAC name is 3-[(2,4-dinitrophenyl)diazenyl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 3-[(2,4-dinitrophenyl)diazenyl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 71357558 |
| Molecular Formula | C17H10N4O7 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[(2,4-dinitrophenyl)diazenyl]oxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2cc1O/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10N4O7/c22-17(23)13-7-10-3-1-2-4-11(10)8-16(13)28-19-18-14-6-5-12(20(24)25)9-15(14)21(26)27/h1-9H,(H,22,23)/b19-18+ |
| InChIKey | GWZNPSXRPFKQAJ-VHEBQXMUSA-N |
| XLogP | 4.43 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|