C16H10N4O6 — CID 3094136
4-[(2,4-dinitrophenyl)diazenyl]naphthalene-1,8-diol (PubChem CID 3094136) has the molecular formula C16H10N4O6 and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)diazenyl]naphthalene-1,8-diol.
| Compound Name | 4-[(2,4-dinitrophenyl)diazenyl]naphthalene-1,8-diol |
|---|---|
| PubChem CID | 3094136 |
| Molecular Formula | C16H10N4O6 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)diazenyl]naphthalene-1,8-diol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(O)c3c(O)cccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10N4O6/c21-14-3-1-2-10-11(6-7-15(22)16(10)14)17-18-12-5-4-9(19(23)24)8-13(12)20(25)26/h1-8,21-22H/b18-17+ |
| InChIKey | IJBKBVSQMJIFJI-ISLYRVAYSA-N |
| XLogP | 4.48 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|