C17H12ClN3O7S2 — CID 135819037
5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonyl chloride (PubChem CID 135819037) has the molecular formula C17H12ClN3O7S2 and a molecular weight of 469.88 g/mol. Its IUPAC name is 5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonyl chloride.
| Compound Name | 5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 135819037 |
| Molecular Formula | C17H12ClN3O7S2 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | 5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonyl chloride |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])ccc1/N=N/c1ccc(O)c2cccc(S(=O)(=O)Cl)c12 |
| InChI | InChI=1S/C17H12ClN3O7S2/c1-29(25,26)16-9-10(21(23)24)5-6-12(16)19-20-13-7-8-14(22)11-3-2-4-15(17(11)13)30(18,27)28/h2-9,22H,1H3/b20-19+ |
| InChIKey | BIXLRNCHGZIFHB-FMQUCBEESA-N |
| XLogP | 4.20 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|