About 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride
2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride (PubChem CID 159304937) has the molecular formula C14H14ClN3O8S2
and a molecular weight of 451.87 g/mol. Its IUPAC name is 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride |
| PubChem CID | 159304937 |
| Molecular Formula | C14H14ClN3O8S2 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl.Cc1ccc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H6ClNO4S.C7H8N2O4S/c2*1-5-2-3-6(9(10)11)4-7(5)14(8,12)13/h2-4H,1H3;2-4H,1H3,(H2,8,12,13) |
| InChIKey | LBULUYCVRWUCSO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 180.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride?
The IUPAC name of 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride (CID 159304937) is 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride.
What is the SMILES notation for 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride?
The canonical SMILES for 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride is Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl.Cc1ccc([N+](=O)[O-])cc1S(N)(=O)=O.
What is the InChIKey of 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride?
The InChIKey is LBULUYCVRWUCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO4S.C7H8N2O4S/c2*1-5-2-3-6(9(10)11)4-7(5)14(8,12)13/h2-4H,1H3;2-4H,1H3,(H2,8,12,13).
What are the key properties of 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride?
2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride has a molecular weight of 451.87 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitrobenzenesulfonamide;2-methyl-5-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 159304937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).