About 2-methyl-5-nitroaniline sulfate
2-methyl-5-nitroaniline sulfate (PubChem CID 20841862) has the molecular formula C7H8N2O6S-2
and a molecular weight of 248.22 g/mol. Its IUPAC name is 2-methyl-5-nitroaniline sulfate.
Molecular Properties
| Compound Name | 2-methyl-5-nitroaniline sulfate |
| PubChem CID | 20841862 |
| Molecular Formula | C7H8N2O6S-2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-methyl-5-nitroaniline sulfate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C7H8N2O2.H2O4S/c1-5-2-3-6(9(10)11)4-7(5)8;1-5(2,3)4/h2-4H,8H2,1H3;(H2,1,2,3,4)/p-2 |
| InChIKey | JNISSFMGFHAVBD-UHFFFAOYSA-L |
| XLogP | 0.15 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitroaniline sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitroaniline sulfate?
The IUPAC name of 2-methyl-5-nitroaniline sulfate (CID 20841862) is 2-methyl-5-nitroaniline sulfate.
What is the SMILES notation for 2-methyl-5-nitroaniline sulfate?
The canonical SMILES for 2-methyl-5-nitroaniline sulfate is Cc1ccc([N+](=O)[O-])cc1N.O=S(=O)([O-])[O-].
What is the InChIKey of 2-methyl-5-nitroaniline sulfate?
The InChIKey is JNISSFMGFHAVBD-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8N2O2.H2O4S/c1-5-2-3-6(9(10)11)4-7(5)8;1-5(2,3)4/h2-4H,8H2,1H3;(H2,1,2,3,4)/p-2.
What are the key properties of 2-methyl-5-nitroaniline sulfate?
2-methyl-5-nitroaniline sulfate has a molecular weight of 248.22 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitroaniline sulfate is sourced from PubChem (CID 20841862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).