About sodium;2-amino-5-nitrobenzenesulfonate;azane
sodium;2-amino-5-nitrobenzenesulfonate;azane (PubChem CID 173065886) has the molecular formula C6H8N3NaO5S
and a molecular weight of 257.20 g/mol. Its IUPAC name is sodium;2-amino-5-nitrobenzenesulfonate;azane.
Molecular Properties
| Compound Name | sodium;2-amino-5-nitrobenzenesulfonate;azane |
| PubChem CID | 173065886 |
| Molecular Formula | C6H8N3NaO5S |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | sodium;2-amino-5-nitrobenzenesulfonate;azane |
| SMILES | N.Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H6N2O5S.H3N.Na/c7-5-2-1-4(8(9)10)3-6(5)14(11,12)13;;/h1-3H,7H2,(H,11,12,13);1H3;/q;;+1/p-1 |
| InChIKey | DDJWOKSAPCPHIA-UHFFFAOYSA-M |
| XLogP | -2.75 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-amino-5-nitrobenzenesulfonate;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-amino-5-nitrobenzenesulfonate;azane?
The IUPAC name of sodium;2-amino-5-nitrobenzenesulfonate;azane (CID 173065886) is sodium;2-amino-5-nitrobenzenesulfonate;azane.
What is the SMILES notation for sodium;2-amino-5-nitrobenzenesulfonate;azane?
The canonical SMILES for sodium;2-amino-5-nitrobenzenesulfonate;azane is N.Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium;2-amino-5-nitrobenzenesulfonate;azane?
The InChIKey is DDJWOKSAPCPHIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N2O5S.H3N.Na/c7-5-2-1-4(8(9)10)3-6(5)14(11,12)13;;/h1-3H,7H2,(H,11,12,13);1H3;/q;;+1/p-1.
What are the key properties of sodium;2-amino-5-nitrobenzenesulfonate;azane?
sodium;2-amino-5-nitrobenzenesulfonate;azane has a molecular weight of 257.20 g/mol, XLogP of -2.75, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-amino-5-nitrobenzenesulfonate;azane is sourced from PubChem (CID 173065886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).