lithium 2,5-diaminobenzenesulfonate

C6H7LiN2O3S — CID 101305300

IUPAClithium 2,5-diaminobenzenesulfonate
SMILESNc1ccc(N)c(S(=O)(=O)[O-])c1.[Li+]
InChIInChI=1S/C6H8N2O3S.Li/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,7-8H2,(H,9,10,11);/q;+1/p-1
InChIKeyVDQXIJJNZWVDBV-UHFFFAOYSA-M
MW194.14 g/mol
LogP-3.24
Rot. Bonds1

About lithium 2,5-diaminobenzenesulfonate

lithium 2,5-diaminobenzenesulfonate (PubChem CID 101305300) has the molecular formula C6H7LiN2O3S and a molecular weight of 194.14 g/mol. Its IUPAC name is lithium 2,5-diaminobenzenesulfonate.

Molecular Properties

Compound Namelithium 2,5-diaminobenzenesulfonate
PubChem CID101305300
Molecular FormulaC6H7LiN2O3S
Molecular Weight194.14 g/mol
Exact Mass194.03
IUPAC Namelithium 2,5-diaminobenzenesulfonate
SMILESNc1ccc(N)c(S(=O)(=O)[O-])c1.[Li+]
InChIInChI=1S/C6H8N2O3S.Li/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,7-8H2,(H,9,10,11);/q;+1/p-1
InChIKeyVDQXIJJNZWVDBV-UHFFFAOYSA-M
XLogP-3.24
TPSA109.24 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.14
LogP ≤ 5-3.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze lithium 2,5-diaminobenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium 2,5-diaminobenzenesulfonate?
The IUPAC name of lithium 2,5-diaminobenzenesulfonate (CID 101305300) is lithium 2,5-diaminobenzenesulfonate.
What is the SMILES notation for lithium 2,5-diaminobenzenesulfonate?
The canonical SMILES for lithium 2,5-diaminobenzenesulfonate is Nc1ccc(N)c(S(=O)(=O)[O-])c1.[Li+].
What is the InChIKey of lithium 2,5-diaminobenzenesulfonate?
The InChIKey is VDQXIJJNZWVDBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N2O3S.Li/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,7-8H2,(H,9,10,11);/q;+1/p-1.
What are the key properties of lithium 2,5-diaminobenzenesulfonate?
lithium 2,5-diaminobenzenesulfonate has a molecular weight of 194.14 g/mol, XLogP of -3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2,5-diaminobenzenesulfonate is sourced from PubChem (CID 101305300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).