C6H7LiN2O3S — CID 101305300
lithium 2,5-diaminobenzenesulfonate (PubChem CID 101305300) has the molecular formula C6H7LiN2O3S and a molecular weight of 194.14 g/mol. Its IUPAC name is lithium 2,5-diaminobenzenesulfonate.
| Compound Name | lithium 2,5-diaminobenzenesulfonate |
|---|---|
| PubChem CID | 101305300 |
| Molecular Formula | C6H7LiN2O3S |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | lithium 2,5-diaminobenzenesulfonate |
| SMILES | Nc1ccc(N)c(S(=O)(=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C6H8N2O3S.Li/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,7-8H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | VDQXIJJNZWVDBV-UHFFFAOYSA-M |
| XLogP | -3.24 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|