C11H21N3O3S — CID 139769798
2,5-diaminobenzenesulfonate;pentylazanium (PubChem CID 139769798) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2,5-diaminobenzenesulfonate;pentylazanium.
| Compound Name | 2,5-diaminobenzenesulfonate;pentylazanium |
|---|---|
| PubChem CID | 139769798 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2,5-diaminobenzenesulfonate;pentylazanium |
| SMILES | CCCCC[NH3+].Nc1ccc(N)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C6H8N2O3S.C5H13N/c7-4-1-2-5(8)6(3-4)12(9,10)11;1-2-3-4-5-6/h1-3H,7-8H2,(H,9,10,11);2-6H2,1H3 |
| InChIKey | KGAGXQGRGADVEM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|