About 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium
2,5-diaminobenzenesulfonate;diethyl(methyl)azanium (PubChem CID 139769754) has the molecular formula C11H21N3O3S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium.
Molecular Properties
| Compound Name | 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium |
| PubChem CID | 139769754 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium |
| SMILES | CC[NH+](C)CC.Nc1ccc(N)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C6H8N2O3S.C5H13N/c7-4-1-2-5(8)6(3-4)12(9,10)11;1-4-6(3)5-2/h1-3H,7-8H2,(H,9,10,11);4-5H2,1-3H3 |
| InChIKey | RFZUUYBICHDIHA-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium?
The IUPAC name of 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium (CID 139769754) is 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium.
What is the SMILES notation for 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium?
The canonical SMILES for 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium is CC[NH+](C)CC.Nc1ccc(N)c(S(=O)(=O)[O-])c1.
What is the InChIKey of 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium?
The InChIKey is RFZUUYBICHDIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S.C5H13N/c7-4-1-2-5(8)6(3-4)12(9,10)11;1-4-6(3)5-2/h1-3H,7-8H2,(H,9,10,11);4-5H2,1-3H3.
What are the key properties of 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium?
2,5-diaminobenzenesulfonate;diethyl(methyl)azanium has a molecular weight of 275.37 g/mol, XLogP of -0.70, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diaminobenzenesulfonate;diethyl(methyl)azanium is sourced from PubChem (CID 139769754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).