C36H42N4O6S2 — CID 139769812
4,6-diaminobenzene-1,3-disulfonate;bis(dibenzyl(methyl)azanium) (PubChem CID 139769812) has the molecular formula C36H42N4O6S2 and a molecular weight of 690.89 g/mol. Its IUPAC name is 4,6-diaminobenzene-1,3-disulfonate;bis(dibenzyl(methyl)azanium).
| Compound Name | 4,6-diaminobenzene-1,3-disulfonate;bis(dibenzyl(methyl)azanium) |
|---|---|
| PubChem CID | 139769812 |
| Molecular Formula | C36H42N4O6S2 |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 4,6-diaminobenzene-1,3-disulfonate;bis(dibenzyl(methyl)azanium) |
| SMILES | C[NH+](Cc1ccccc1)Cc1ccccc1.C[NH+](Cc1ccccc1)Cc1ccccc1.Nc1cc(N)c(S(=O)(=O)[O-])cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/2C15H17N.C6H8N2O6S2/c2*1-16(12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15;7-3-1-4(8)6(16(12,13)14)2-5(3)15(9,10)11/h2*2-11H,12-13H2,1H3;1-2H,7-8H2,(H,9,10,11)(H,12,13,14) |
| InChIKey | XFCCEKRKEADGCG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|