C10H22N4O6S2 — CID 139769877
4,6-diaminobenzene-1,3-disulfonate;bis(dimethylazanium) (PubChem CID 139769877) has the molecular formula C10H22N4O6S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4,6-diaminobenzene-1,3-disulfonate;bis(dimethylazanium).
| Compound Name | 4,6-diaminobenzene-1,3-disulfonate;bis(dimethylazanium) |
|---|---|
| PubChem CID | 139769877 |
| Molecular Formula | C10H22N4O6S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4,6-diaminobenzene-1,3-disulfonate;bis(dimethylazanium) |
| SMILES | C[NH2+]C.C[NH2+]C.Nc1cc(N)c(S(=O)(=O)[O-])cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C6H8N2O6S2.2C2H7N/c7-3-1-4(8)6(16(12,13)14)2-5(3)15(9,10)11;2*1-3-2/h1-2H,7-8H2,(H,9,10,11)(H,12,13,14);2*3H,1-2H3 |
| InChIKey | DUQOKFYCXXBZJT-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 199.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|