C12H23N3O3S — CID 139769865
2,5-diaminobenzenesulfonate;di(propan-2-yl)azanium (PubChem CID 139769865) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2,5-diaminobenzenesulfonate;di(propan-2-yl)azanium.
| Compound Name | 2,5-diaminobenzenesulfonate;di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 139769865 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2,5-diaminobenzenesulfonate;di(propan-2-yl)azanium |
| SMILES | CC(C)[NH2+]C(C)C.Nc1ccc(N)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C6H8N2O3S.C6H15N/c7-4-1-2-5(8)6(3-4)12(9,10)11;1-5(2)7-6(3)4/h1-3H,7-8H2,(H,9,10,11);5-7H,1-4H3 |
| InChIKey | KXZQXPAZRCDDLP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|