C6H7N2NaO3S — CID 23678866
sodium 2,4-diaminobenzenesulfonate (PubChem CID 23678866) has the molecular formula C6H7N2NaO3S and a molecular weight of 210.19 g/mol. Its IUPAC name is sodium 2,4-diaminobenzenesulfonate.
| Compound Name | sodium 2,4-diaminobenzenesulfonate |
|---|---|
| PubChem CID | 23678866 |
| Molecular Formula | C6H7N2NaO3S |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | sodium 2,4-diaminobenzenesulfonate |
| SMILES | Nc1ccc(S(=O)(=O)[O-])c(N)c1.[Na+] |
| InChI | InChI=1S/C6H8N2O3S.Na/c7-4-1-2-6(5(8)3-4)12(9,10)11;/h1-3H,7-8H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | WYSWTEPAYPNWDV-UHFFFAOYSA-M |
| XLogP | -3.24 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|