C6H6K2N2O6S2 — CID 139977776
dipotassium;4,6-diaminobenzene-1,3-disulfonate (PubChem CID 139977776) has the molecular formula C6H6K2N2O6S2 and a molecular weight of 344.45 g/mol. Its IUPAC name is dipotassium;4,6-diaminobenzene-1,3-disulfonate.
| Compound Name | dipotassium;4,6-diaminobenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 139977776 |
| Molecular Formula | C6H6K2N2O6S2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 343.89 |
| IUPAC Name | dipotassium;4,6-diaminobenzene-1,3-disulfonate |
| SMILES | Nc1cc(N)c(S(=O)(=O)[O-])cc1S(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C6H8N2O6S2.2K/c7-3-1-4(8)6(16(12,13)14)2-5(3)15(9,10)11;;/h1-2H,7-8H2,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | MYDZZRPDKMUTGO-UHFFFAOYSA-L |
| XLogP | -7.33 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | -7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|