C8H12N2O4S2 — CID 177497967
4,6-bis(methylsulfonyl)benzene-1,3-diamine (PubChem CID 177497967) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4,6-bis(methylsulfonyl)benzene-1,3-diamine.
| Compound Name | 4,6-bis(methylsulfonyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 177497967 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4,6-bis(methylsulfonyl)benzene-1,3-diamine |
| SMILES | CS(=O)(=O)c1cc(S(C)(=O)=O)c(N)cc1N |
| InChI | InChI=1S/C8H12N2O4S2/c1-15(11,12)7-4-8(16(2,13)14)6(10)3-5(7)9/h3-4H,9-10H2,1-2H3 |
| InChIKey | MPLDENXVQPYFOJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|