C10H14N3O9S3- — CID 139595142
diazanium;7-aminonaphthalene-1,3,6-trisulfonate (PubChem CID 139595142) has the molecular formula C10H14N3O9S3- and a molecular weight of 416.44 g/mol. Its IUPAC name is diazanium;7-aminonaphthalene-1,3,6-trisulfonate.
| Compound Name | diazanium;7-aminonaphthalene-1,3,6-trisulfonate |
|---|---|
| PubChem CID | 139595142 |
| Molecular Formula | C10H14N3O9S3- |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | diazanium;7-aminonaphthalene-1,3,6-trisulfonate |
| SMILES | Nc1cc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2cc1S(=O)(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C10H9NO9S3.2H3N/c11-8-4-7-5(2-10(8)23(18,19)20)1-6(21(12,13)14)3-9(7)22(15,16)17;;/h1-4H,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20);2*1H3/p-1 |
| InChIKey | GTFTYISZEPQXHQ-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 270.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|