C10H7K2NO6S2 — CID 2762591
dipotassium;6-aminonaphthalene-1,3-disulfonate (PubChem CID 2762591) has the molecular formula C10H7K2NO6S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is dipotassium;6-aminonaphthalene-1,3-disulfonate.
| Compound Name | dipotassium;6-aminonaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 2762591 |
| Molecular Formula | C10H7K2NO6S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | dipotassium;6-aminonaphthalene-1,3-disulfonate |
| SMILES | Nc1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1.[K+].[K+] |
| InChI | InChI=1S/C10H9NO6S2.2K/c11-7-1-2-9-6(3-7)4-8(18(12,13)14)5-10(9)19(15,16)17;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | RXXREFZUDCKCOQ-UHFFFAOYSA-L |
| XLogP | -5.76 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | -5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|