About dipotassium;6-aminonaphthalene-1,3-disulfonate
dipotassium;6-aminonaphthalene-1,3-disulfonate (PubChem CID 2762591) has the molecular formula C10H7K2NO6S2
and a molecular weight of 379.50 g/mol. Its IUPAC name is dipotassium;6-aminonaphthalene-1,3-disulfonate.
Molecular Properties
| Compound Name | dipotassium;6-aminonaphthalene-1,3-disulfonate |
| PubChem CID | 2762591 |
| Molecular Formula | C10H7K2NO6S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | dipotassium;6-aminonaphthalene-1,3-disulfonate |
| SMILES | Nc1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1.[K+].[K+] |
| InChI | InChI=1S/C10H9NO6S2.2K/c11-7-1-2-9-6(3-7)4-8(18(12,13)14)5-10(9)19(15,16)17;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | RXXREFZUDCKCOQ-UHFFFAOYSA-L |
| XLogP | -5.76 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | -5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;6-aminonaphthalene-1,3-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;6-aminonaphthalene-1,3-disulfonate?
The IUPAC name of dipotassium;6-aminonaphthalene-1,3-disulfonate (CID 2762591) is dipotassium;6-aminonaphthalene-1,3-disulfonate.
What is the SMILES notation for dipotassium;6-aminonaphthalene-1,3-disulfonate?
The canonical SMILES for dipotassium;6-aminonaphthalene-1,3-disulfonate is Nc1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1.[K+].[K+].
What is the InChIKey of dipotassium;6-aminonaphthalene-1,3-disulfonate?
The InChIKey is RXXREFZUDCKCOQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO6S2.2K/c11-7-1-2-9-6(3-7)4-8(18(12,13)14)5-10(9)19(15,16)17;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2.
What are the key properties of dipotassium;6-aminonaphthalene-1,3-disulfonate?
dipotassium;6-aminonaphthalene-1,3-disulfonate has a molecular weight of 379.50 g/mol, XLogP of -5.76, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;6-aminonaphthalene-1,3-disulfonate is sourced from PubChem (CID 2762591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).