C10H7NNa2O7S2 — CID 16176
disodium;4-amino-3-hydroxynaphthalene-2,7-disulfonate (PubChem CID 16176) has the molecular formula C10H7NNa2O7S2 and a molecular weight of 363.28 g/mol. Its IUPAC name is disodium;4-amino-3-hydroxynaphthalene-2,7-disulfonate.
| Compound Name | disodium;4-amino-3-hydroxynaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 16176 |
| Molecular Formula | C10H7NNa2O7S2 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | disodium;4-amino-3-hydroxynaphthalene-2,7-disulfonate |
| SMILES | Nc1c(O)c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C10H9NO7S2.2Na/c11-9-7-2-1-6(19(13,14)15)3-5(7)4-8(10(9)12)20(16,17)18;;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);;/q;2*+1/p-2 |
| InChIKey | WWKQYOVTXCEQDS-UHFFFAOYSA-L |
| XLogP | -6.06 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|