C16H10N2O7S2-2 — CID 3947723
3-hydroxy-4-phenyldiazenylnaphthalene-2,7-disulfonate (PubChem CID 3947723) has the molecular formula C16H10N2O7S2-2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 3-hydroxy-4-phenyldiazenylnaphthalene-2,7-disulfonate.
| Compound Name | 3-hydroxy-4-phenyldiazenylnaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 3947723 |
| Molecular Formula | C16H10N2O7S2-2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 3-hydroxy-4-phenyldiazenylnaphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(/N=N/c3ccccc3)c(O)c(S(=O)(=O)[O-])cc2c1 |
| InChI | InChI=1S/C16H12N2O7S2/c19-16-14(27(23,24)25)9-10-8-12(26(20,21)22)6-7-13(10)15(16)18-17-11-4-2-1-3-5-11/h1-9,19H,(H,20,21,22)(H,23,24,25)/p-2/b18-17+ |
| InChIKey | UWCKWDYDKZIRGN-ISLYRVAYSA-L |
| XLogP | 2.77 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|