C20H20N2O7S2 — CID 136912425
4-[(4-tert-butylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136912425) has the molecular formula C20H20N2O7S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[(4-tert-butylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136912425 |
| Molecular Formula | C20H20N2O7S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[(4-tert-butylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CC(C)(C)c1ccc(/N=N/c2c(O)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)cc1 |
| InChI | InChI=1S/C20H20N2O7S2/c1-20(2,3)13-4-6-14(7-5-13)21-22-18-16-9-8-15(30(24,25)26)10-12(16)11-17(19(18)23)31(27,28)29/h4-11,23H,1-3H3,(H,24,25,26)(H,27,28,29)/b22-21+ |
| InChIKey | BKBFMIBIMAEDJE-QURGRASLSA-N |
| XLogP | 4.75 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|