C16H11ClN2O8S2 — CID 136857527
4-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136857527) has the molecular formula C16H11ClN2O8S2 and a molecular weight of 458.86 g/mol. Its IUPAC name is 4-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136857527 |
| Molecular Formula | C16H11ClN2O8S2 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 4-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3cc(Cl)ccc3O)c(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C16H11ClN2O8S2/c17-9-1-4-13(20)12(7-9)18-19-15-11-3-2-10(28(22,23)24)5-8(11)6-14(16(15)21)29(25,26)27/h1-7,20-21H,(H,22,23,24)(H,25,26,27)/b19-18+ |
| InChIKey | PKTLDYGVNMGGEQ-VHEBQXMUSA-N |
| XLogP | 3.81 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|