C16H12N2O11S3 — CID 163411937
4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 163411937) has the molecular formula C16H12N2O11S3 and a molecular weight of 504.48 g/mol. Its IUPAC name is 4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 163411937 |
| Molecular Formula | C16H12N2O11S3 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | 4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc3c2O)c1 |
| InChI | InChI=1S/C16H12N2O11S3/c19-13-4-2-10(31(24,25)26)7-12(13)17-18-15-14(32(27,28)29)6-8-5-9(30(21,22)23)1-3-11(8)16(15)20/h1-7,19-20H,(H,21,22,23)(H,24,25,26)(H,27,28,29)/b18-17+ |
| InChIKey | ABFTZYUBVFRMLB-ISLYRVAYSA-N |
| XLogP | 2.41 |
| TPSA | 228.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|