C22H17N5Na2O7S2 — CID 137180855
CID 137180855 (PubChem CID 137180855) has the molecular formula C22H17N5Na2O7S2 and a molecular weight of 573.52 g/mol.
| Compound Name | CID 137180855 |
|---|---|
| PubChem CID | 137180855 |
| Molecular Formula | C22H17N5Na2O7S2 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | — |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)cc3)c(S(=O)(=O)O)cc2c1.[Na].[Na] |
| InChI | InChI=1S/C22H17N5O7S2.2Na/c23-14-1-10-19-13(11-14)12-20(36(32,33)34)21(22(19)28)27-26-16-4-2-15(3-5-16)24-25-17-6-8-18(9-7-17)35(29,30)31;;/h1-12,28H,23H2,(H,29,30,31)(H,32,33,34);;/b25-24+,27-26+;; |
| InChIKey | XXKFBWUABDABJR-JQIYNFIASA-N |
| XLogP | 4.69 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|