C29H27N5O8S2 — CID 144549463
4-aminobenzenesulfonic acid;3-[(4-aminophenyl)diazenyl]-7-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 144549463) has the molecular formula C29H27N5O8S2 and a molecular weight of 637.70 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;3-[(4-aminophenyl)diazenyl]-7-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 4-aminobenzenesulfonic acid;3-[(4-aminophenyl)diazenyl]-7-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 144549463 |
| Molecular Formula | C29H27N5O8S2 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | 4-aminobenzenesulfonic acid;3-[(4-aminophenyl)diazenyl]-7-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | C=C/C=C(\C=C)C(=O)Nc1ccc2c(O)c(/N=N/c3ccc(N)cc3)c(S(=O)(=O)O)cc2c1.Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H20N4O5S.C6H7NO3S/c1-3-5-14(4-2)23(29)25-18-10-11-19-15(12-18)13-20(33(30,31)32)21(22(19)28)27-26-17-8-6-16(24)7-9-17;7-5-1-3-6(4-2-5)11(8,9)10/h3-13,28H,1-2,24H2,(H,25,29)(H,30,31,32);1-4H,7H2,(H,8,9,10)/b14-5+,27-26+; |
| InChIKey | QVWOGZMNZHUKLS-QPURMKRJSA-N |
| XLogP | 5.54 |
| TPSA | 234.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|