C31H25N7O8S2 — CID 136603061
3-[[2,5-dimethyl-4-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-7-formamido-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136603061) has the molecular formula C31H25N7O8S2 and a molecular weight of 687.72 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-4-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-7-formamido-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 3-[[2,5-dimethyl-4-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-7-formamido-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136603061 |
| Molecular Formula | C31H25N7O8S2 |
| Molecular Weight | 687.72 g/mol |
| Exact Mass | 687.12 |
| IUPAC Name | 3-[[2,5-dimethyl-4-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-7-formamido-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(NC=O)ccc3c2O)c(C)cc1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H25N7O8S2/c1-18-14-28(37-38-30-29(48(44,45)46)16-20-15-24(32-17-39)9-12-26(20)31(30)40)19(2)13-27(18)36-35-22-5-3-21(4-6-22)33-34-23-7-10-25(11-8-23)47(41,42)43/h3-17,40H,1-2H3,(H,32,39)(H,41,42,43)(H,44,45,46)/b34-33+,36-35+,38-37+ |
| InChIKey | YBHRVCFLCJWFPF-SSJVSHEYSA-N |
| XLogP | 8.47 |
| TPSA | 232.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|