C20H17N3O7S2 — CID 136785035
7-acetamido-3-[(4-ethenylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136785035) has the molecular formula C20H17N3O7S2 and a molecular weight of 475.50 g/mol. Its IUPAC name is 7-acetamido-3-[(4-ethenylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-acetamido-3-[(4-ethenylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136785035 |
| Molecular Formula | C20H17N3O7S2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 7-acetamido-3-[(4-ethenylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(NC(C)=O)ccc3c2O)cc1 |
| InChI | InChI=1S/C20H17N3O7S2/c1-3-31(26,27)16-7-4-14(5-8-16)22-23-19-18(32(28,29)30)11-13-10-15(21-12(2)24)6-9-17(13)20(19)25/h3-11,25H,1H2,2H3,(H,21,24)(H,28,29,30)/b23-22+ |
| InChIKey | IKPBEHITGJHXCO-GHVJWSGMSA-N |
| XLogP | 4.08 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|