C28H27N5O9S — CID 137230739
7-acetamido-4-hydroxy-3-[[4-[[4-(2-hydroxyethoxy)phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137230739) has the molecular formula C28H27N5O9S and a molecular weight of 609.62 g/mol. Its IUPAC name is 7-acetamido-4-hydroxy-3-[[4-[[4-(2-hydroxyethoxy)phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-acetamido-4-hydroxy-3-[[4-[[4-(2-hydroxyethoxy)phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137230739 |
| Molecular Formula | C28H27N5O9S |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | 7-acetamido-4-hydroxy-3-[[4-[[4-(2-hydroxyethoxy)phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(NC(C)=O)ccc3c2O)c(OC)cc1/N=N/c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H27N5O9S/c1-16(35)29-19-6-9-21-17(12-19)13-26(43(37,38)39)27(28(21)36)33-32-23-15-24(40-2)22(14-25(23)41-3)31-30-18-4-7-20(8-5-18)42-11-10-34/h4-9,12-15,34,36H,10-11H2,1-3H3,(H,29,35)(H,37,38,39)/b31-30+,33-32+ |
| InChIKey | QSMRJFHZEQQZQO-CJQWSLHQSA-N |
| XLogP | 5.97 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|