C29H29N5O7 — CID 137184225
N-[5-hydroxy-6-[[4-[[2-(2-hydroxyethoxy)-4-methoxyphenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalen-2-yl]acetamide (PubChem CID 137184225) has the molecular formula C29H29N5O7 and a molecular weight of 559.58 g/mol. Its IUPAC name is N-[5-hydroxy-6-[[4-[[2-(2-hydroxyethoxy)-4-methoxyphenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalen-2-yl]acetamide.
| Compound Name | N-[5-hydroxy-6-[[4-[[2-(2-hydroxyethoxy)-4-methoxyphenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 137184225 |
| Molecular Formula | C29H29N5O7 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[5-hydroxy-6-[[4-[[2-(2-hydroxyethoxy)-4-methoxyphenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalen-2-yl]acetamide |
| SMILES | COc1ccc(/N=N/c2cc(OC)c(/N=N/c3ccc4cc(NC(C)=O)ccc4c3O)cc2OC)c(OCCO)c1 |
| InChI | InChI=1S/C29H29N5O7/c1-17(36)30-19-6-8-21-18(13-19)5-9-23(29(21)37)32-34-25-16-26(39-3)24(15-27(25)40-4)33-31-22-10-7-20(38-2)14-28(22)41-12-11-35/h5-10,13-16,35,37H,11-12H2,1-4H3,(H,30,36)/b33-31+,34-32+ |
| InChIKey | ZGSVFCOXCBLUIE-FMWAKIAMSA-N |
| XLogP | 6.73 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|