C49H43N7O5 — CID 140963067
6-(4-methoxyanilino)-2-[[2-methoxy-4-[[2-methoxy-4-[(6-propoxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-5-methylphenyl]diazenyl]naphthalen-1-ol (PubChem CID 140963067) has the molecular formula C49H43N7O5 and a molecular weight of 809.93 g/mol. Its IUPAC name is 6-(4-methoxyanilino)-2-[[2-methoxy-4-[[2-methoxy-4-[(6-propoxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-5-methylphenyl]diazenyl]naphthalen-1-ol.
| Compound Name | 6-(4-methoxyanilino)-2-[[2-methoxy-4-[[2-methoxy-4-[(6-propoxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-5-methylphenyl]diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 140963067 |
| Molecular Formula | C49H43N7O5 |
| Molecular Weight | 809.93 g/mol |
| Exact Mass | 809.33 |
| IUPAC Name | 6-(4-methoxyanilino)-2-[[2-methoxy-4-[[2-methoxy-4-[(6-propoxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-5-methylphenyl]diazenyl]naphthalen-1-ol |
| SMILES | CCCOc1ccc2cc(/N=N/c3cc(OC)c(/N=N/c4cc(OC)c(/N=N/c5ccc6cc(Nc7ccc(OC)cc7)ccc6c5O)cc4C)c4ccccc34)ccc2c1 |
| InChI | InChI=1S/C49H43N7O5/c1-6-23-61-38-18-12-31-25-36(14-11-32(31)27-38)51-54-44-29-47(60-5)48(41-10-8-7-9-40(41)44)56-53-43-28-46(59-4)45(24-30(43)2)55-52-42-22-13-33-26-35(17-21-39(33)49(42)57)50-34-15-19-37(58-3)20-16-34/h7-22,24-29,50,57H,6,23H2,1-5H3/b54-51+,55-52+,56-53+ |
| InChIKey | LGVUMDNIDKQALF-SFTFRQRHSA-N |
| XLogP | 14.96 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.93 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|