C44H33N7O2 — CID 140963156
6-anilino-2-[[2-methoxy-4-[[4-[(2-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-ol (PubChem CID 140963156) has the molecular formula C44H33N7O2 and a molecular weight of 691.80 g/mol. Its IUPAC name is 6-anilino-2-[[2-methoxy-4-[[4-[(2-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-ol.
| Compound Name | 6-anilino-2-[[2-methoxy-4-[[4-[(2-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 140963156 |
| Molecular Formula | C44H33N7O2 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 6-anilino-2-[[2-methoxy-4-[[4-[(2-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-yl]diazenyl]naphthalen-1-ol |
| SMILES | COc1cc(/N=N/c2ccc(/N=N/c3ccccc3C)c3ccccc23)c2ccccc2c1/N=N/c1ccc2cc(Nc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C44H33N7O2/c1-28-12-6-11-19-37(28)46-47-38-24-25-39(34-16-8-7-15-33(34)38)48-50-41-27-42(53-2)43(36-18-10-9-17-35(36)41)51-49-40-23-20-29-26-31(21-22-32(29)44(40)52)45-30-13-4-3-5-14-30/h3-27,45,52H,1-2H3/b47-46+,50-48+,51-49+ |
| InChIKey | JSMBJJAYIXERBK-QGRPUDRPSA-N |
| XLogP | 14.16 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|