C45H39N9O6S — CID 136606702
2-[[4-[[4-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-3-methoxyphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-propoxyphenyl]diazenyl]benzenesulfonic acid (PubChem CID 136606702) has the molecular formula C45H39N9O6S and a molecular weight of 833.93 g/mol. Its IUPAC name is 2-[[4-[[4-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-3-methoxyphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-propoxyphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[[4-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-3-methoxyphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-propoxyphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136606702 |
| Molecular Formula | C45H39N9O6S |
| Molecular Weight | 833.93 g/mol |
| Exact Mass | 833.27 |
| IUPAC Name | 2-[[4-[[4-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-3-methoxyphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-propoxyphenyl]diazenyl]benzenesulfonic acid |
| SMILES | CCCOc1cc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc5cc(Nc6ccccc6)ccc5c4O)c(OC)c3)cc2C)ccc1/N=N/c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C45H39N9O6S/c1-4-24-60-43-28-35(18-23-39(43)52-53-40-12-8-9-13-44(40)61(56,57)58)49-50-37-21-16-33(25-29(37)2)47-48-34-17-22-38(42(27-34)59-3)51-54-41-20-14-30-26-32(15-19-36(30)45(41)55)46-31-10-6-5-7-11-31/h5-23,25-28,46,55H,4,24H2,1-3H3,(H,56,57,58)/b48-47+,50-49+,53-52+,54-51+ |
| InChIKey | YCOXUCBILQXPAX-MVGSFESUSA-N |
| XLogP | 14.30 |
| TPSA | 203.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.93 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|