C45H39N9O4S — CID 159093565
2-[[4-[[4-[[4-[[6-(benzylamino)-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 159093565) has the molecular formula C45H39N9O4S and a molecular weight of 801.93 g/mol. Its IUPAC name is 2-[[4-[[4-[[4-[[6-(benzylamino)-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[[4-[[4-[[6-(benzylamino)-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 159093565 |
| Molecular Formula | C45H39N9O4S |
| Molecular Weight | 801.93 g/mol |
| Exact Mass | 801.28 |
| IUPAC Name | 2-[[4-[[4-[[4-[[6-(benzylamino)-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(/N=N/c2cc(C)c(/N=N/c3ccc4cc(NCc5ccccc5)ccc4c3O)cc2C)ccc1/N=N/c1ccc(/N=N/c2ccccc2S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C45H39N9O4S/c1-28-22-36(16-20-38(28)49-47-35-17-21-39(29(2)23-35)50-51-40-12-8-9-13-44(40)59(56,57)58)48-53-42-24-31(4)43(25-30(42)3)54-52-41-19-14-33-26-34(15-18-37(33)45(41)55)46-27-32-10-6-5-7-11-32/h5-26,46,55H,27H2,1-4H3,(H,56,57,58)/b49-47+,51-50+,53-48+,54-52+ |
| InChIKey | JWFGPQCCHSJCAG-QOTKVAAGSA-N |
| XLogP | 14.30 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.93 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|