C37H32N8O5S — CID 136510809
2-[[4-[[4-[[6-[(4-aminophenoxy)amino]-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 136510809) has the molecular formula C37H32N8O5S and a molecular weight of 700.78 g/mol. Its IUPAC name is 2-[[4-[[4-[[6-[(4-aminophenoxy)amino]-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[[4-[[6-[(4-aminophenoxy)amino]-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136510809 |
| Molecular Formula | C37H32N8O5S |
| Molecular Weight | 700.78 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 2-[[4-[[4-[[6-[(4-aminophenoxy)amino]-1-hydroxynaphthalen-2-yl]diazenyl]-2,5-dimethylphenyl]diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc3cc(NOc4ccc(N)cc4)ccc3c2O)c(C)cc1/N=N/c1ccc(/N=N/c2ccccc2S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C37H32N8O5S/c1-22-18-27(12-17-31(22)40-41-32-6-4-5-7-36(32)51(47,48)49)39-43-34-19-24(3)35(20-23(34)2)44-42-33-16-8-25-21-28(11-15-30(25)37(33)46)45-50-29-13-9-26(38)10-14-29/h4-21,45-46H,38H2,1-3H3,(H,47,48,49)/b41-40+,43-39+,44-42+ |
| InChIKey | LNJRFDXRBZVTHQ-BPZQIHDBSA-N |
| XLogP | 10.95 |
| TPSA | 196.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.78 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|