C27H27N5O12S2 — CID 142007649
6-amino-3-[[2,5-bis(2-hydroxyethoxy)-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 142007649) has the molecular formula C27H27N5O12S2 and a molecular weight of 677.67 g/mol. Its IUPAC name is 6-amino-3-[[2,5-bis(2-hydroxyethoxy)-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-3-[[2,5-bis(2-hydroxyethoxy)-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 142007649 |
| Molecular Formula | C27H27N5O12S2 |
| Molecular Weight | 677.67 g/mol |
| Exact Mass | 677.11 |
| IUPAC Name | 6-amino-3-[[2,5-bis(2-hydroxyethoxy)-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | COc1ccc(/N=N/c2cc(OCCO)c(/N=N/c3c(S(=O)(=O)O)cc4ccc(N)cc4c3O)cc2OCCO)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C27H27N5O12S2/c1-42-17-4-5-19(24(12-17)45(36,37)38)29-30-20-13-23(44-9-7-34)21(14-22(20)43-8-6-33)31-32-26-25(46(39,40)41)10-15-2-3-16(28)11-18(15)27(26)35/h2-5,10-14,33-35H,6-9,28H2,1H3,(H,36,37,38)(H,39,40,41)/b30-29+,32-31+ |
| InChIKey | JKWDBXUTQYCOGC-PNBBGTCESA-N |
| XLogP | 4.20 |
| TPSA | 272.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|