C24H30N4O10S3 — CID 136735874
6-[2-(diethylamino)ethylsulfonylmethylamino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136735874) has the molecular formula C24H30N4O10S3 and a molecular weight of 630.72 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethylsulfonylmethylamino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-[2-(diethylamino)ethylsulfonylmethylamino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136735874 |
| Molecular Formula | C24H30N4O10S3 |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | 6-[2-(diethylamino)ethylsulfonylmethylamino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CCN(CC)CCS(=O)(=O)CNc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(OC)cc3S(=O)(=O)O)c(O)c2c1 |
| InChI | InChI=1S/C24H30N4O10S3/c1-4-28(5-2)10-11-39(30,31)15-25-17-7-6-16-12-22(41(35,36)37)23(24(29)19(16)13-17)27-26-20-9-8-18(38-3)14-21(20)40(32,33)34/h6-9,12-14,25,29H,4-5,10-11,15H2,1-3H3,(H,32,33,34)(H,35,36,37)/b27-26+ |
| InChIKey | VCPZWHXQZQOMDK-CYYJNZCTSA-N |
| XLogP | 3.59 |
| TPSA | 212.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|