C17H14N6O11S3 — CID 142193687
4-amino-5-hydroxy-6-[(4-methoxy-2-sulfophenyl)diazenyl]-7-(trinitroso-λ4-sulfanyl)naphthalene-2-sulfonic acid (PubChem CID 142193687) has the molecular formula C17H14N6O11S3 and a molecular weight of 574.53 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-[(4-methoxy-2-sulfophenyl)diazenyl]-7-(trinitroso-λ4-sulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-5-hydroxy-6-[(4-methoxy-2-sulfophenyl)diazenyl]-7-(trinitroso-λ4-sulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 142193687 |
| Molecular Formula | C17H14N6O11S3 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | 4-amino-5-hydroxy-6-[(4-methoxy-2-sulfophenyl)diazenyl]-7-(trinitroso-λ4-sulfanyl)naphthalene-2-sulfonic acid |
| SMILES | COc1ccc(/N=N/c2c(S(N=O)(N=O)N=O)cc3cc(S(=O)(=O)O)cc(N)c3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H14N6O11S3/c1-34-9-2-3-12(13(6-9)37(31,32)33)19-20-16-14(35(21-25,22-26)23-27)5-8-4-10(36(28,29)30)7-11(18)15(8)17(16)24/h2-7,24H,18H2,1H3,(H,28,29,30)(H,31,32,33)/b20-19+ |
| InChIKey | BHQAULXFFGBBOM-FMQUCBEESA-N |
| XLogP | 4.25 |
| TPSA | 277.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|