C31H27N7O9S2 — CID 163479138
3-[[4-[[4-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methylphenyl]diazenyl]phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid (PubChem CID 163479138) has the molecular formula C31H27N7O9S2 and a molecular weight of 705.73 g/mol. Its IUPAC name is 3-[[4-[[4-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methylphenyl]diazenyl]phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[[4-[[4-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methylphenyl]diazenyl]phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 163479138 |
| Molecular Formula | C31H27N7O9S2 |
| Molecular Weight | 705.73 g/mol |
| Exact Mass | 705.13 |
| IUPAC Name | 3-[[4-[[4-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methylphenyl]diazenyl]phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)cc(O)c5c4O)cc3)c(C)c2)c(C)cc1N |
| InChI | InChI=1S/C31H27N7O9S2/c1-16-10-21(35-37-25-15-27(47-3)23(32)11-17(25)2)8-9-24(16)36-33-19-4-6-20(7-5-19)34-38-30-28(49(44,45)46)13-18-12-22(48(41,42)43)14-26(39)29(18)31(30)40/h4-15,39-40H,32H2,1-3H3,(H,41,42,43)(H,44,45,46)/b36-33+,37-35+,38-34+ |
| InChIKey | CDABDSNHMGOFLD-MIYISRMYSA-N |
| XLogP | 8.20 |
| TPSA | 258.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.73 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|