C30H25N7O11S3 — CID 136646691
6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136646691) has the molecular formula C30H25N7O11S3 and a molecular weight of 755.77 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136646691 |
| Molecular Formula | C30H25N7O11S3 |
| Molecular Weight | 755.77 g/mol |
| Exact Mass | 755.08 |
| IUPAC Name | 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1/N=N/c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N)cc3c2O)cc1C |
| InChI | InChI=1S/C30H25N7O11S3/c1-16-11-19(34-37-29-28(51(45,46)47)13-17-12-27(50(42,43)44)23(31)15-22(17)30(29)38)5-9-24(16)35-36-25-10-6-20(14-26(25)48-2)33-32-18-3-7-21(8-4-18)49(39,40)41/h3-15,38H,31H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b33-32+,36-35+,37-34+ |
| InChIKey | NGSVANFPTDFEBC-JKPDAUHISA-N |
| XLogP | 7.43 |
| TPSA | 292.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.77 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|