C26H19N5O10S3 — CID 135627073
6-amino-4-hydroxy-3-[[4-[(4-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135627073) has the molecular formula C26H19N5O10S3 and a molecular weight of 657.66 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[[4-[(4-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-4-hydroxy-3-[[4-[(4-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135627073 |
| Molecular Formula | C26H19N5O10S3 |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.03 |
| IUPAC Name | 6-amino-4-hydroxy-3-[[4-[(4-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)c4ccccc34)c(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C26H19N5O10S3/c27-20-13-19-14(11-23(20)43(36,37)38)12-24(44(39,40)41)25(26(19)32)31-30-22-10-9-21(17-3-1-2-4-18(17)22)29-28-15-5-7-16(8-6-15)42(33,34)35/h1-13,32H,27H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)/b29-28+,31-30+ |
| InChIKey | NCOWSYKNMAMAQN-DUJDKOHPSA-N |
| XLogP | 5.85 |
| TPSA | 258.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|