C16H14N4O10S3 — CID 165341644
6-amino-3-[(4-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 165341644) has the molecular formula C16H14N4O10S3 and a molecular weight of 518.51 g/mol. Its IUPAC name is 6-amino-3-[(4-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-3-[(4-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 165341644 |
| Molecular Formula | C16H14N4O10S3 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | 6-amino-3-[(4-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N)cc3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H14N4O10S3/c17-8-1-2-11(13(5-8)32(25,26)27)19-20-15-14(33(28,29)30)4-7-3-12(31(22,23)24)10(18)6-9(7)16(15)21/h1-6,21H,17-18H2,(H,22,23,24)(H,25,26,27)(H,28,29,30)/b20-19+ |
| InChIKey | QLKGCCKKCCMGEG-FMQUCBEESA-N |
| XLogP | 1.87 |
| TPSA | 260.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|