C32H22F2N6O8S2 — CID 153382271
6-amino-3-[[4-[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 153382271) has the molecular formula C32H22F2N6O8S2 and a molecular weight of 720.69 g/mol. Its IUPAC name is 6-amino-3-[[4-[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-3-[[4-[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 153382271 |
| Molecular Formula | C32H22F2N6O8S2 |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 720.09 |
| IUPAC Name | 6-amino-3-[[4-[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccc(-c4ccc(/N=N/c5c(S(=O)(=O)O)cc6ccc(N)cc6c5O)c(F)c4)cc3F)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C32H22F2N6O8S2/c33-23-10-15(2-7-25(23)37-39-29-28(50(46,47)48)13-18-9-19(35)5-6-21(18)31(29)41)16-3-8-26(24(34)11-16)38-40-30-27(49(43,44)45)12-17-1-4-20(36)14-22(17)32(30)42/h1-14,41-42H,35-36H2,(H,43,44,45)(H,46,47,48)/b39-37+,40-38+ |
| InChIKey | JIJKCXWLNJFNKL-HVMBLDELSA-N |
| XLogP | 7.84 |
| TPSA | 250.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|