C28H21N5O8S2 — CID 3544716
7-amino-4-hydroxy-3-[[4-[4-[(4-hydroxy-2-sulfophenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 3544716) has the molecular formula C28H21N5O8S2 and a molecular weight of 619.64 g/mol. Its IUPAC name is 7-amino-4-hydroxy-3-[[4-[4-[(4-hydroxy-2-sulfophenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-hydroxy-3-[[4-[4-[(4-hydroxy-2-sulfophenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 3544716 |
| Molecular Formula | C28H21N5O8S2 |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 7-amino-4-hydroxy-3-[[4-[4-[(4-hydroxy-2-sulfophenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)cc5S(=O)(=O)O)cc4)cc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C28H21N5O8S2/c29-19-5-11-23-18(13-19)14-26(43(39,40)41)27(28(23)35)33-31-21-8-3-17(4-9-21)16-1-6-20(7-2-16)30-32-24-12-10-22(34)15-25(24)42(36,37)38/h1-15,34-35H,29H2,(H,36,37,38)(H,39,40,41)/b32-30+,33-31+ |
| InChIKey | LBGIGKKBCWDMBD-RRPBDJRISA-N |
| XLogP | 6.82 |
| TPSA | 224.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|