C21H17N3O7S2 — CID 137082020
7-amino-4-hydroxy-3-[(4-methyl-7-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137082020) has the molecular formula C21H17N3O7S2 and a molecular weight of 487.52 g/mol. Its IUPAC name is 7-amino-4-hydroxy-3-[(4-methyl-7-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-hydroxy-3-[(4-methyl-7-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137082020 |
| Molecular Formula | C21H17N3O7S2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 7-amino-4-hydroxy-3-[(4-methyl-7-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(N)ccc3c2O)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C21H17N3O7S2/c1-11-2-7-18(17-10-14(32(26,27)28)4-6-15(11)17)23-24-20-19(33(29,30)31)9-12-8-13(22)3-5-16(12)21(20)25/h2-10,25H,22H2,1H3,(H,26,27,28)(H,29,30,31)/b24-23+ |
| InChIKey | XYHVSZBYUTUPCQ-WCWDXBQESA-N |
| XLogP | 4.50 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|