C25H23N5O7S — CID 137230687
7-amino-4-hydroxy-3-[[4-[(4-hydroxy-2-methoxyphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137230687) has the molecular formula C25H23N5O7S and a molecular weight of 537.55 g/mol. Its IUPAC name is 7-amino-4-hydroxy-3-[[4-[(4-hydroxy-2-methoxyphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-hydroxy-3-[[4-[(4-hydroxy-2-methoxyphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137230687 |
| Molecular Formula | C25H23N5O7S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 7-amino-4-hydroxy-3-[[4-[(4-hydroxy-2-methoxyphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(O)ccc1/N=N/c1cc(OC)c(/N=N/c2c(S(=O)(=O)O)cc3cc(N)ccc3c2O)cc1C |
| InChI | InChI=1S/C25H23N5O7S/c1-13-8-20(22(37-3)12-19(13)28-27-18-7-5-16(31)11-21(18)36-2)29-30-24-23(38(33,34)35)10-14-9-15(26)4-6-17(14)25(24)32/h4-12,31-32H,26H2,1-3H3,(H,33,34,35)/b28-27+,30-29+ |
| InChIKey | VAABQWRKQWOMAN-XOXGWFOHSA-N |
| XLogP | 6.24 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|