C30H31N5O10S — CID 137230759
7-acetamido-3-[[4-[[2,4-bis(2-hydroxyethoxy)phenyl]diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137230759) has the molecular formula C30H31N5O10S and a molecular weight of 653.67 g/mol. Its IUPAC name is 7-acetamido-3-[[4-[[2,4-bis(2-hydroxyethoxy)phenyl]diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-acetamido-3-[[4-[[2,4-bis(2-hydroxyethoxy)phenyl]diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137230759 |
| Molecular Formula | C30H31N5O10S |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | 7-acetamido-3-[[4-[[2,4-bis(2-hydroxyethoxy)phenyl]diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(OCCO)cc2OCCO)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(NC(C)=O)ccc2c1O |
| InChI | InChI=1S/C30H31N5O10S/c1-17-12-25(26(43-3)16-24(17)33-32-23-7-5-21(44-10-8-36)15-27(23)45-11-9-37)34-35-29-28(46(40,41)42)14-19-13-20(31-18(2)38)4-6-22(19)30(29)39/h4-7,12-16,36-37,39H,8-11H2,1-3H3,(H,31,38)(H,40,41,42)/b33-32+,35-34+ |
| InChIKey | NTXJDJNWIQLYBL-VPHDGDOJSA-N |
| XLogP | 5.64 |
| TPSA | 221.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|