C30H27N5O14S4 — CID 135965426
2-[[5-(2-hydroxyethoxy)-4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 135965426) has the molecular formula C30H27N5O14S4 and a molecular weight of 809.83 g/mol. Its IUPAC name is 2-[[5-(2-hydroxyethoxy)-4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[[5-(2-hydroxyethoxy)-4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 135965426 |
| Molecular Formula | C30H27N5O14S4 |
| Molecular Weight | 809.83 g/mol |
| Exact Mass | 809.04 |
| IUPAC Name | 2-[[5-(2-hydroxyethoxy)-4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(NS(C)(=O)=O)ccc3c2O)c(OCCO)cc1/N=N/c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C30H27N5O14S4/c1-16-12-24(33-34-28-27(52(43,44)45)14-17-13-18(35-50(2,38)39)6-7-19(17)29(28)37)25(49-11-10-36)15-23(16)32-31-22-9-8-20-21(30(22)53(46,47)48)4-3-5-26(20)51(40,41)42/h3-9,12-15,35-37H,10-11H2,1-2H3,(H,40,41,42)(H,43,44,45)(H,46,47,48)/b32-31+,34-33+ |
| InChIKey | SPJOSYAVMKSNTR-HSBKYFPUSA-N |
| XLogP | 5.32 |
| TPSA | 308.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|